C29H32N6O6 — CID 166455443
(5S)-N-ethyl-2-oxo-N'-[2-oxo-1-[2-oxo-2-(2-phenylethylamino)ethyl]-3-pyridinyl]-5-(pyridine-3-carbonylamino)hexanediamide (PubChem CID 166455443) has the molecular formula C29H32N6O6 and a molecular weight of 560.61 g/mol. Its IUPAC name is (5S)-N-ethyl-2-oxo-N'-[2-oxo-1-[2-oxo-2-(2-phenylethylamino)ethyl]-3-pyridinyl]-5-(pyridine-3-carbonylamino)hexanediamide.
| Compound Name | (5S)-N-ethyl-2-oxo-N'-[2-oxo-1-[2-oxo-2-(2-phenylethylamino)ethyl]-3-pyridinyl]-5-(pyridine-3-carbonylamino)hexanediamide |
|---|---|
| PubChem CID | 166455443 |
| Molecular Formula | C29H32N6O6 |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | (5S)-N-ethyl-2-oxo-N'-[2-oxo-1-[2-oxo-2-(2-phenylethylamino)ethyl]-3-pyridinyl]-5-(pyridine-3-carbonylamino)hexanediamide |
| SMILES | CCNC(=O)C(=O)CC[C@H](NC(=O)c1cccnc1)C(=O)Nc1cccn(CC(=O)NCCc2ccccc2)c1=O |
| InChI | InChI=1S/C29H32N6O6/c1-2-31-28(40)24(36)13-12-22(33-26(38)21-10-6-15-30-18-21)27(39)34-23-11-7-17-35(29(23)41)19-25(37)32-16-14-20-8-4-3-5-9-20/h3-11,15,17-18,22H,2,12-14,16,19H2,1H3,(H,31,40)(H,32,37)(H,33,38)(H,34,39)/t22-/m0/s1 |
| InChIKey | IOKKIDNGKNWXPS-QFIPXVFZSA-N |
| XLogP | 0.82 |
| TPSA | 168.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|