C34H40N6O6 — CID 166455337
(2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-ethyl-2-(1H-indole-3-carbonylamino)-5-oxohexanediamide (PubChem CID 166455337) has the molecular formula C34H40N6O6 and a molecular weight of 628.73 g/mol. Its IUPAC name is (2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-ethyl-2-(1H-indole-3-carbonylamino)-5-oxohexanediamide.
| Compound Name | (2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-ethyl-2-(1H-indole-3-carbonylamino)-5-oxohexanediamide |
|---|---|
| PubChem CID | 166455337 |
| Molecular Formula | C34H40N6O6 |
| Molecular Weight | 628.73 g/mol |
| Exact Mass | 628.30 |
| IUPAC Name | (2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-ethyl-2-(1H-indole-3-carbonylamino)-5-oxohexanediamide |
| SMILES | CCNC(=O)C(=O)CC[C@H](NC(=O)c1c[nH]c2ccccc12)C(=O)Nc1cccn(CC(=O)NC2C3CC4CC(C3)CC2C4)c1=O |
| InChI | InChI=1S/C34H40N6O6/c1-2-35-33(45)28(41)10-9-26(37-31(43)24-17-36-25-7-4-3-6-23(24)25)32(44)38-27-8-5-11-40(34(27)46)18-29(42)39-30-21-13-19-12-20(15-21)16-22(30)14-19/h3-8,11,17,19-22,26,30,36H,2,9-10,12-16,18H2,1H3,(H,35,45)(H,37,43)(H,38,44)(H,39,42)/t19?,20?,21?,22?,26-,30?/m0/s1 |
| InChIKey | RSCLADDLONMGMJ-UHVHUWOKSA-N |
| XLogP | 2.49 |
| TPSA | 171.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.73 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|