C34H42N6O6 — CID 167286101
(2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-5-hydroxy-N'-methyl-2-[(3-methyl-1H-indole-2-carbonyl)amino]hexanediamide (PubChem CID 167286101) has the molecular formula C34H42N6O6 and a molecular weight of 630.75 g/mol. Its IUPAC name is (2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-5-hydroxy-N'-methyl-2-[(3-methyl-1H-indole-2-carbonyl)amino]hexanediamide.
| Compound Name | (2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-5-hydroxy-N'-methyl-2-[(3-methyl-1H-indole-2-carbonyl)amino]hexanediamide |
|---|---|
| PubChem CID | 167286101 |
| Molecular Formula | C34H42N6O6 |
| Molecular Weight | 630.75 g/mol |
| Exact Mass | 630.32 |
| IUPAC Name | (2S)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-5-hydroxy-N'-methyl-2-[(3-methyl-1H-indole-2-carbonyl)amino]hexanediamide |
| SMILES | CNC(=O)C(O)CC[C@H](NC(=O)c1[nH]c2ccccc2c1C)C(=O)Nc1cccn(CC(=O)NC2C3CC4CC(C3)CC2C4)c1=O |
| InChI | InChI=1S/C34H42N6O6/c1-18-23-6-3-4-7-24(23)36-29(18)33(45)37-25(9-10-27(41)32(44)35-2)31(43)38-26-8-5-11-40(34(26)46)17-28(42)39-30-21-13-19-12-20(15-21)16-22(30)14-19/h3-8,11,19-22,25,27,30,36,41H,9-10,12-17H2,1-2H3,(H,35,44)(H,37,45)(H,38,43)(H,39,42)/t19?,20?,21?,22?,25-,27?,30?/m0/s1 |
| InChIKey | XWXJFTPMJXLOFE-SZZAFADVSA-N |
| XLogP | 2.20 |
| TPSA | 174.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.75 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|