C32H41N7O10S — CID 166455348
(2S)-N-[1-[2-[(5-acetamido-2-adamantyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-ethyl-5-oxo-2-[(5-sulfamoylfuran-3-carbonyl)amino]hexanediamide (PubChem CID 166455348) has the molecular formula C32H41N7O10S and a molecular weight of 715.79 g/mol. Its IUPAC name is (2S)-N-[1-[2-[(5-acetamido-2-adamantyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-ethyl-5-oxo-2-[(5-sulfamoylfuran-3-carbonyl)amino]hexanediamide.
| Compound Name | (2S)-N-[1-[2-[(5-acetamido-2-adamantyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-ethyl-5-oxo-2-[(5-sulfamoylfuran-3-carbonyl)amino]hexanediamide |
|---|---|
| PubChem CID | 166455348 |
| Molecular Formula | C32H41N7O10S |
| Molecular Weight | 715.79 g/mol |
| Exact Mass | 715.26 |
| IUPAC Name | (2S)-N-[1-[2-[(5-acetamido-2-adamantyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-ethyl-5-oxo-2-[(5-sulfamoylfuran-3-carbonyl)amino]hexanediamide |
| SMILES | CCNC(=O)C(=O)CC[C@H](NC(=O)c1coc(S(N)(=O)=O)c1)C(=O)Nc1cccn(CC(=O)NC2C3CC4CC2CC(NC(C)=O)(C4)C3)c1=O |
| InChI | InChI=1S/C32H41N7O10S/c1-3-34-30(45)24(41)7-6-22(35-28(43)21-11-26(49-16-21)50(33,47)48)29(44)36-23-5-4-8-39(31(23)46)15-25(42)37-27-19-9-18-10-20(27)14-32(12-18,13-19)38-17(2)40/h4-5,8,11,16,18-20,22,27H,3,6-7,9-10,12-15H2,1-2H3,(H,34,45)(H,35,43)(H,36,44)(H,37,42)(H,38,40)(H2,33,47,48)/t18?,19?,20?,22-,27?,32?/m0/s1 |
| InChIKey | IGNIWPZZZHKVHF-CIPLWRHNSA-N |
| XLogP | -0.49 |
| TPSA | 257.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.79 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|