C32H33N5O7 — CID 177147175
(E)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-2-(1-benzofuran-2-carbonylamino)-5-oxohex-2-enediamide (PubChem CID 177147175) has the molecular formula C32H33N5O7 and a molecular weight of 599.64 g/mol. Its IUPAC name is (E)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-2-(1-benzofuran-2-carbonylamino)-5-oxohex-2-enediamide.
| Compound Name | (E)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-2-(1-benzofuran-2-carbonylamino)-5-oxohex-2-enediamide |
|---|---|
| PubChem CID | 177147175 |
| Molecular Formula | C32H33N5O7 |
| Molecular Weight | 599.64 g/mol |
| Exact Mass | 599.24 |
| IUPAC Name | (E)-N-[1-[2-(2-adamantylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-2-(1-benzofuran-2-carbonylamino)-5-oxohex-2-enediamide |
| SMILES | NC(=O)C(=O)C/C=C(/NC(=O)c1cc2ccccc2o1)C(=O)Nc1cccn(CC(=O)NC2C3CC4CC(C3)CC2C4)c1=O |
| InChI | InChI=1S/C32H33N5O7/c33-29(40)24(38)8-7-22(34-31(42)26-15-19-4-1-2-6-25(19)44-26)30(41)35-23-5-3-9-37(32(23)43)16-27(39)36-28-20-11-17-10-18(13-20)14-21(28)12-17/h1-7,9,15,17-18,20-21,28H,8,10-14,16H2,(H2,33,40)(H,34,42)(H,35,41)(H,36,39)/b22-7+ |
| InChIKey | IYSZOELDDLHETG-QPJQQBGISA-N |
| XLogP | 2.23 |
| TPSA | 182.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.64 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|