C35H41N5O7 — CID 166455798
(2S)-N-[1-[2-(1-bicyclo[1.1.1]pentanylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-cyclohexyl-2-[(3-ethyl-1-benzofuran-2-carbonyl)amino]-5-oxohexanediamide (PubChem CID 166455798) has the molecular formula C35H41N5O7 and a molecular weight of 643.74 g/mol. Its IUPAC name is (2S)-N-[1-[2-(1-bicyclo[1.1.1]pentanylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-cyclohexyl-2-[(3-ethyl-1-benzofuran-2-carbonyl)amino]-5-oxohexanediamide.
| Compound Name | (2S)-N-[1-[2-(1-bicyclo[1.1.1]pentanylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-cyclohexyl-2-[(3-ethyl-1-benzofuran-2-carbonyl)amino]-5-oxohexanediamide |
|---|---|
| PubChem CID | 166455798 |
| Molecular Formula | C35H41N5O7 |
| Molecular Weight | 643.74 g/mol |
| Exact Mass | 643.30 |
| IUPAC Name | (2S)-N-[1-[2-(1-bicyclo[1.1.1]pentanylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-cyclohexyl-2-[(3-ethyl-1-benzofuran-2-carbonyl)amino]-5-oxohexanediamide |
| SMILES | CCc1c(C(=O)N[C@@H](CCC(=O)C(=O)NC2CCCCC2)C(=O)Nc2cccn(CC(=O)NC34CC(C3)C4)c2=O)oc2ccccc12 |
| InChI | InChI=1S/C35H41N5O7/c1-2-23-24-11-6-7-13-28(24)47-30(23)33(45)37-25(14-15-27(41)32(44)36-22-9-4-3-5-10-22)31(43)38-26-12-8-16-40(34(26)46)20-29(42)39-35-17-21(18-35)19-35/h6-8,11-13,16,21-22,25H,2-5,9-10,14-15,17-20H2,1H3,(H,36,44)(H,37,45)(H,38,43)(H,39,42)/t21?,25-,35?/m0/s1 |
| InChIKey | SZDXBTPJBJRSLS-TXWSIENYSA-N |
| XLogP | 3.36 |
| TPSA | 168.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.74 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|