C36H43N5O7 — CID 166455779
(5S)-N-cyclopropyl-5-[(3-methyl-1-benzofuran-2-carbonyl)amino]-N'-[1-[2-[(3-methyl-2-bicyclo[3.3.1]nonanyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-2-oxohexanediamide (PubChem CID 166455779) has the molecular formula C36H43N5O7 and a molecular weight of 657.77 g/mol. Its IUPAC name is (5S)-N-cyclopropyl-5-[(3-methyl-1-benzofuran-2-carbonyl)amino]-N'-[1-[2-[(3-methyl-2-bicyclo[3.3.1]nonanyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-2-oxohexanediamide.
| Compound Name | (5S)-N-cyclopropyl-5-[(3-methyl-1-benzofuran-2-carbonyl)amino]-N'-[1-[2-[(3-methyl-2-bicyclo[3.3.1]nonanyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-2-oxohexanediamide |
|---|---|
| PubChem CID | 166455779 |
| Molecular Formula | C36H43N5O7 |
| Molecular Weight | 657.77 g/mol |
| Exact Mass | 657.32 |
| IUPAC Name | (5S)-N-cyclopropyl-5-[(3-methyl-1-benzofuran-2-carbonyl)amino]-N'-[1-[2-[(3-methyl-2-bicyclo[3.3.1]nonanyl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-2-oxohexanediamide |
| SMILES | Cc1c(C(=O)N[C@@H](CCC(=O)C(=O)NC2CC2)C(=O)Nc2cccn(CC(=O)NC3C(C)CC4CCCC3C4)c2=O)oc2ccccc12 |
| InChI | InChI=1S/C36H43N5O7/c1-20-17-22-7-5-8-23(18-22)31(20)40-30(43)19-41-16-6-10-27(36(41)47)39-33(44)26(14-15-28(42)34(45)37-24-12-13-24)38-35(46)32-21(2)25-9-3-4-11-29(25)48-32/h3-4,6,9-11,16,20,22-24,26,31H,5,7-8,12-15,17-19H2,1-2H3,(H,37,45)(H,38,46)(H,39,44)(H,40,43)/t20?,22?,23?,26-,31?/m0/s1 |
| InChIKey | VUUBUAIJDDBDSS-WDNPVQBUSA-N |
| XLogP | 3.60 |
| TPSA | 168.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.77 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|