C25H45NO — CID 167290828
N-[[4-(2,2-dimethylpropoxy)phenyl]methyl]-N,8,8-trimethyldecan-1-amine (PubChem CID 167290828) has the molecular formula C25H45NO and a molecular weight of 375.64 g/mol. Its IUPAC name is N-[[4-(2,2-dimethylpropoxy)phenyl]methyl]-N,8,8-trimethyldecan-1-amine.
| Compound Name | N-[[4-(2,2-dimethylpropoxy)phenyl]methyl]-N,8,8-trimethyldecan-1-amine |
|---|---|
| PubChem CID | 167290828 |
| Molecular Formula | C25H45NO |
| Molecular Weight | 375.64 g/mol |
| Exact Mass | 375.35 |
| IUPAC Name | N-[[4-(2,2-dimethylpropoxy)phenyl]methyl]-N,8,8-trimethyldecan-1-amine |
| SMILES | CCC(C)(C)CCCCCCCN(C)Cc1ccc(OCC(C)(C)C)cc1 |
| InChI | InChI=1S/C25H45NO/c1-8-25(5,6)18-12-10-9-11-13-19-26(7)20-22-14-16-23(17-15-22)27-21-24(2,3)4/h14-17H,8-13,18-21H2,1-7H3 |
| InChIKey | ZNOPUNQQIKFMRR-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.64 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|