C13H14ClN3O — CID 167292889
trans-(1R,3R)-3-[(4-chlorophthalazin-1-yl)amino]cyclopentan-1-ol (PubChem CID 167292889) has the molecular formula C13H14ClN3O and a molecular weight of 263.73 g/mol. Its IUPAC name is trans-(1R,3R)-3-[(4-chlorophthalazin-1-yl)amino]cyclopentan-1-ol.
| Compound Name | trans-(1R,3R)-3-[(4-chlorophthalazin-1-yl)amino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 167292889 |
| Molecular Formula | C13H14ClN3O |
| Molecular Weight | 263.73 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | trans-(1R,3R)-3-[(4-chlorophthalazin-1-yl)amino]cyclopentan-1-ol |
| SMILES | O[C@@H]1CC[C@@H](Nc2nnc(Cl)c3ccccc23)C1 |
| InChI | InChI=1S/C13H14ClN3O/c14-12-10-3-1-2-4-11(10)13(17-16-12)15-8-5-6-9(18)7-8/h1-4,8-9,18H,5-7H2,(H,15,17)/t8-,9-/m1/s1 |
| InChIKey | CDOFMSDEPNPLPI-RKDXNWHRSA-N |
| XLogP | 2.61 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.73 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |