C21H20F3N3O2 — CID 167292905
2-[4-[[(1S,2S)-2-hydroxycyclohexyl]amino]phthalazin-1-yl]-5-(trifluoromethyl)phenol (PubChem CID 167292905) has the molecular formula C21H20F3N3O2 and a molecular weight of 403.40 g/mol. Its IUPAC name is 2-[4-[[(1S,2S)-2-hydroxycyclohexyl]amino]phthalazin-1-yl]-5-(trifluoromethyl)phenol.
| Compound Name | 2-[4-[[(1S,2S)-2-hydroxycyclohexyl]amino]phthalazin-1-yl]-5-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 167292905 |
| Molecular Formula | C21H20F3N3O2 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 2-[4-[[(1S,2S)-2-hydroxycyclohexyl]amino]phthalazin-1-yl]-5-(trifluoromethyl)phenol |
| SMILES | Oc1cc(C(F)(F)F)ccc1-c1nnc(N[C@H]2CCCC[C@@H]2O)c2ccccc12 |
| InChI | InChI=1S/C21H20F3N3O2/c22-21(23,24)12-9-10-15(18(29)11-12)19-13-5-1-2-6-14(13)20(27-26-19)25-16-7-3-4-8-17(16)28/h1-2,5-6,9-11,16-17,28-29H,3-4,7-8H2,(H,25,27)/t16-,17-/m0/s1 |
| InChIKey | PAXBXEHRSWBRTN-IRXDYDNUSA-N |
| XLogP | 4.74 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |