C22H22F3N3O2 — CID 175538440
(1S)-2-[[4-[2-hydroxy-4-(trifluoromethyl)phenyl]phthalazin-1-yl]amino]cycloheptan-1-ol (PubChem CID 175538440) has the molecular formula C22H22F3N3O2 and a molecular weight of 417.43 g/mol. Its IUPAC name is (1S)-2-[[4-[2-hydroxy-4-(trifluoromethyl)phenyl]phthalazin-1-yl]amino]cycloheptan-1-ol.
| Compound Name | (1S)-2-[[4-[2-hydroxy-4-(trifluoromethyl)phenyl]phthalazin-1-yl]amino]cycloheptan-1-ol |
|---|---|
| PubChem CID | 175538440 |
| Molecular Formula | C22H22F3N3O2 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (1S)-2-[[4-[2-hydroxy-4-(trifluoromethyl)phenyl]phthalazin-1-yl]amino]cycloheptan-1-ol |
| SMILES | Oc1cc(C(F)(F)F)ccc1-c1nnc(NC2CCCCC[C@@H]2O)c2ccccc12 |
| InChI | InChI=1S/C22H22F3N3O2/c23-22(24,25)13-10-11-16(19(30)12-13)20-14-6-4-5-7-15(14)21(28-27-20)26-17-8-2-1-3-9-18(17)29/h4-7,10-12,17-18,29-30H,1-3,8-9H2,(H,26,28)/t17?,18-/m0/s1 |
| InChIKey | UNGBGUYEHDOUHR-ZVAWYAOSSA-N |
| XLogP | 5.13 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |