C29H34N2O2 — CID 167292922
4-[[2-methyl-1-[4-(1-phenylethenoxymethyl)phenyl]propyl]amino]-N-propylbenzamide (PubChem CID 167292922) has the molecular formula C29H34N2O2 and a molecular weight of 442.60 g/mol. Its IUPAC name is 4-[[2-methyl-1-[4-(1-phenylethenoxymethyl)phenyl]propyl]amino]-N-propylbenzamide.
| Compound Name | 4-[[2-methyl-1-[4-(1-phenylethenoxymethyl)phenyl]propyl]amino]-N-propylbenzamide |
|---|---|
| PubChem CID | 167292922 |
| Molecular Formula | C29H34N2O2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 4-[[2-methyl-1-[4-(1-phenylethenoxymethyl)phenyl]propyl]amino]-N-propylbenzamide |
| SMILES | C=C(OCc1ccc(C(Nc2ccc(C(=O)NCCC)cc2)C(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H34N2O2/c1-5-19-30-29(32)26-15-17-27(18-16-26)31-28(21(2)3)25-13-11-23(12-14-25)20-33-22(4)24-9-7-6-8-10-24/h6-18,21,28,31H,4-5,19-20H2,1-3H3,(H,30,32) |
| InChIKey | UNZSNOIJNGCRQW-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|