C25H26N4O4 — CID 167294309
(2S,4R)-4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-N-phenylpiperidine-2-carboxamide (PubChem CID 167294309) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is (2S,4R)-4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-N-phenylpiperidine-2-carboxamide.
| Compound Name | (2S,4R)-4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-N-phenylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 167294309 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | (2S,4R)-4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-N-phenylpiperidine-2-carboxamide |
| SMILES | O=C1CCC(N2Cc3cc([C@@H]4CCN[C@H](C(=O)Nc5ccccc5)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H26N4O4/c30-22-9-8-21(24(32)28-22)29-14-17-12-15(6-7-19(17)25(29)33)16-10-11-26-20(13-16)23(31)27-18-4-2-1-3-5-18/h1-7,12,16,20-21,26H,8-11,13-14H2,(H,27,31)(H,28,30,32)/t16-,20+,21?/m1/s1 |
| InChIKey | QQKPMPWEDLOGKX-DPVFXHEMSA-N |
| XLogP | 1.92 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|