C11H6INOS — CID 167294920
5-iodo-1H-[1]benzothiolo[2,3-b]pyridin-4-one (PubChem CID 167294920) has the molecular formula C11H6INOS and a molecular weight of 327.15 g/mol. Its IUPAC name is 5-iodo-1H-[1]benzothiolo[2,3-b]pyridin-4-one.
| Compound Name | 5-iodo-1H-[1]benzothiolo[2,3-b]pyridin-4-one |
|---|---|
| PubChem CID | 167294920 |
| Molecular Formula | C11H6INOS |
| Molecular Weight | 327.15 g/mol |
| Exact Mass | 326.92 |
| IUPAC Name | 5-iodo-1H-[1]benzothiolo[2,3-b]pyridin-4-one |
| SMILES | O=c1cc[nH]c2sc3cccc(I)c3c12 |
| InChI | InChI=1S/C11H6INOS/c12-6-2-1-3-8-9(6)10-7(14)4-5-13-11(10)15-8/h1-5H,(H,13,14) |
| InChIKey | ZEVVVRBVWUPHKS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.15 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|