About 3-chloro-2-methyl-7H-thieno[2,3-b]pyridin-4-one
3-chloro-2-methyl-7H-thieno[2,3-b]pyridin-4-one (PubChem CID 57494354) has the molecular formula C8H6ClNOS
and a molecular weight of 199.66 g/mol. Its IUPAC name is 3-chloro-2-methyl-7H-thieno[2,3-b]pyridin-4-one.
Molecular Properties
| Compound Name | 3-chloro-2-methyl-7H-thieno[2,3-b]pyridin-4-one |
| PubChem CID | 57494354 |
| Molecular Formula | C8H6ClNOS |
| Molecular Weight | 199.66 g/mol |
| Exact Mass | 198.99 |
| IUPAC Name | 3-chloro-2-methyl-7H-thieno[2,3-b]pyridin-4-one |
| SMILES | Cc1sc2[nH]ccc(=O)c2c1Cl |
| InChI | InChI=1S/C8H6ClNOS/c1-4-7(9)6-5(11)2-3-10-8(6)12-4/h2-3H,1H3,(H,10,11) |
| InChIKey | XOXXBFVURICVCE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.66 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-2-methyl-7H-thieno[2,3-b]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-methyl-7H-thieno[2,3-b]pyridin-4-one?
The IUPAC name of 3-chloro-2-methyl-7H-thieno[2,3-b]pyridin-4-one (CID 57494354) is 3-chloro-2-methyl-7H-thieno[2,3-b]pyridin-4-one.
What is the SMILES notation for 3-chloro-2-methyl-7H-thieno[2,3-b]pyridin-4-one?
The canonical SMILES for 3-chloro-2-methyl-7H-thieno[2,3-b]pyridin-4-one is Cc1sc2[nH]ccc(=O)c2c1Cl.
What is the InChIKey of 3-chloro-2-methyl-7H-thieno[2,3-b]pyridin-4-one?
The InChIKey is XOXXBFVURICVCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClNOS/c1-4-7(9)6-5(11)2-3-10-8(6)12-4/h2-3H,1H3,(H,10,11).
What are the key properties of 3-chloro-2-methyl-7H-thieno[2,3-b]pyridin-4-one?
3-chloro-2-methyl-7H-thieno[2,3-b]pyridin-4-one has a molecular weight of 199.66 g/mol, XLogP of 2.55, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-methyl-7H-thieno[2,3-b]pyridin-4-one is sourced from PubChem (CID 57494354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).