About 7-bromo-5,6-dichloro-1H-quinolin-4-one
7-bromo-5,6-dichloro-1H-quinolin-4-one (PubChem CID 138678826) has the molecular formula C9H4BrCl2NO
and a molecular weight of 292.95 g/mol. Its IUPAC name is 7-bromo-5,6-dichloro-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 7-bromo-5,6-dichloro-1H-quinolin-4-one |
| PubChem CID | 138678826 |
| Molecular Formula | C9H4BrCl2NO |
| Molecular Weight | 292.95 g/mol |
| Exact Mass | 290.89 |
| IUPAC Name | 7-bromo-5,6-dichloro-1H-quinolin-4-one |
| SMILES | O=c1cc[nH]c2cc(Br)c(Cl)c(Cl)c12 |
| InChI | InChI=1S/C9H4BrCl2NO/c10-4-3-5-7(9(12)8(4)11)6(14)1-2-13-5/h1-3H,(H,13,14) |
| InChIKey | QNHJCVVSLGNUJK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.95 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-5,6-dichloro-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-5,6-dichloro-1H-quinolin-4-one?
The IUPAC name of 7-bromo-5,6-dichloro-1H-quinolin-4-one (CID 138678826) is 7-bromo-5,6-dichloro-1H-quinolin-4-one.
What is the SMILES notation for 7-bromo-5,6-dichloro-1H-quinolin-4-one?
The canonical SMILES for 7-bromo-5,6-dichloro-1H-quinolin-4-one is O=c1cc[nH]c2cc(Br)c(Cl)c(Cl)c12.
What is the InChIKey of 7-bromo-5,6-dichloro-1H-quinolin-4-one?
The InChIKey is QNHJCVVSLGNUJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4BrCl2NO/c10-4-3-5-7(9(12)8(4)11)6(14)1-2-13-5/h1-3H,(H,13,14).
What are the key properties of 7-bromo-5,6-dichloro-1H-quinolin-4-one?
7-bromo-5,6-dichloro-1H-quinolin-4-one has a molecular weight of 292.95 g/mol, XLogP of 3.60, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-5,6-dichloro-1H-quinolin-4-one is sourced from PubChem (CID 138678826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).