C6H4N2OS — CID 143892400
7H-[1,2]thiazolo[5,4-b]pyridin-4-one (PubChem CID 143892400) has the molecular formula C6H4N2OS and a molecular weight of 152.18 g/mol. Its IUPAC name is 7H-[1,2]thiazolo[5,4-b]pyridin-4-one.
| Compound Name | 7H-[1,2]thiazolo[5,4-b]pyridin-4-one |
|---|---|
| PubChem CID | 143892400 |
| Molecular Formula | C6H4N2OS |
| Molecular Weight | 152.18 g/mol |
| Exact Mass | 152.00 |
| IUPAC Name | 7H-[1,2]thiazolo[5,4-b]pyridin-4-one |
| SMILES | O=c1cc[nH]c2sncc12 |
| InChI | InChI=1S/C6H4N2OS/c9-5-1-2-7-6-4(5)3-8-10-6/h1-3H,(H,7,9) |
| InChIKey | GGXKCLTWFRFWDZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.18 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |