C28H26Cl2N4O2 — CID 16729606
4-[5-[(2,3-dichlorophenyl)methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-4-yl]-N-[(4-methoxyphenyl)methyl]benzamide (PubChem CID 16729606) has the molecular formula C28H26Cl2N4O2 and a molecular weight of 521.45 g/mol. Its IUPAC name is 4-[5-[(2,3-dichlorophenyl)methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-4-yl]-N-[(4-methoxyphenyl)methyl]benzamide.
| Compound Name | 4-[5-[(2,3-dichlorophenyl)methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-4-yl]-N-[(4-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 16729606 |
| Molecular Formula | C28H26Cl2N4O2 |
| Molecular Weight | 521.45 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 4-[5-[(2,3-dichlorophenyl)methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-4-yl]-N-[(4-methoxyphenyl)methyl]benzamide |
| SMILES | COc1ccc(CNC(=O)c2ccc(C3c4nc[nH]c4CCN3Cc3cccc(Cl)c3Cl)cc2)cc1 |
| InChI | InChI=1S/C28H26Cl2N4O2/c1-36-22-11-5-18(6-12-22)15-31-28(35)20-9-7-19(8-10-20)27-26-24(32-17-33-26)13-14-34(27)16-21-3-2-4-23(29)25(21)30/h2-12,17,27H,13-16H2,1H3,(H,31,35)(H,32,33) |
| InChIKey | XWZLOENAKILRNI-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.45 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |