C33H46ClNO3 — CID 167297070
(E)-1-[2-[[3-(4-chloro-2-propylphenyl)-7-(1-hydroxyethyl)-3,4-dihydro-2H-1,5-benzoxazepin-5-yl]methyl]cyclobutyl]oct-2-en-1-ol (PubChem CID 167297070) has the molecular formula C33H46ClNO3 and a molecular weight of 540.19 g/mol. Its IUPAC name is (E)-1-[2-[[3-(4-chloro-2-propylphenyl)-7-(1-hydroxyethyl)-3,4-dihydro-2H-1,5-benzoxazepin-5-yl]methyl]cyclobutyl]oct-2-en-1-ol.
| Compound Name | (E)-1-[2-[[3-(4-chloro-2-propylphenyl)-7-(1-hydroxyethyl)-3,4-dihydro-2H-1,5-benzoxazepin-5-yl]methyl]cyclobutyl]oct-2-en-1-ol |
|---|---|
| PubChem CID | 167297070 |
| Molecular Formula | C33H46ClNO3 |
| Molecular Weight | 540.19 g/mol |
| Exact Mass | 539.32 |
| IUPAC Name | (E)-1-[2-[[3-(4-chloro-2-propylphenyl)-7-(1-hydroxyethyl)-3,4-dihydro-2H-1,5-benzoxazepin-5-yl]methyl]cyclobutyl]oct-2-en-1-ol |
| SMILES | CCCCC/C=C/C(O)C1CCC1CN1CC(c2ccc(Cl)cc2CCC)COc2ccc(C(C)O)cc21 |
| InChI | InChI=1S/C33H46ClNO3/c1-4-6-7-8-9-11-32(37)30-15-12-26(30)20-35-21-27(29-16-14-28(34)18-25(29)10-5-2)22-38-33-17-13-24(23(3)36)19-31(33)35/h9,11,13-14,16-19,23,26-27,30,32,36-37H,4-8,10,12,15,20-22H2,1-3H3/b11-9+ |
| InChIKey | SYCBQCVOMPOFGF-PKNBQFBNSA-N |
| XLogP | 7.85 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.19 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|