C32H45ClN2O5 — CID 153341119
2-[5-[(E)-7-[acetyl(methyl)amino]hept-5-enyl]-3-(4-chloro-2-propylphenyl)-3,4-dihydro-2H-1,5-benzoxazepin-7-yl]-2-hydroxyacetic acid;ethane (PubChem CID 153341119) has the molecular formula C32H45ClN2O5 and a molecular weight of 573.17 g/mol. Its IUPAC name is 2-[5-[(E)-7-[acetyl(methyl)amino]hept-5-enyl]-3-(4-chloro-2-propylphenyl)-3,4-dihydro-2H-1,5-benzoxazepin-7-yl]-2-hydroxyacetic acid;ethane.
| Compound Name | 2-[5-[(E)-7-[acetyl(methyl)amino]hept-5-enyl]-3-(4-chloro-2-propylphenyl)-3,4-dihydro-2H-1,5-benzoxazepin-7-yl]-2-hydroxyacetic acid;ethane |
|---|---|
| PubChem CID | 153341119 |
| Molecular Formula | C32H45ClN2O5 |
| Molecular Weight | 573.17 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | 2-[5-[(E)-7-[acetyl(methyl)amino]hept-5-enyl]-3-(4-chloro-2-propylphenyl)-3,4-dihydro-2H-1,5-benzoxazepin-7-yl]-2-hydroxyacetic acid;ethane |
| SMILES | CC.CCCc1cc(Cl)ccc1C1COc2ccc(C(O)C(=O)O)cc2N(CCCC/C=C/CN(C)C(C)=O)C1 |
| InChI | InChI=1S/C30H39ClN2O5.C2H6/c1-4-10-22-17-25(31)12-13-26(22)24-19-33(16-9-7-5-6-8-15-32(3)21(2)34)27-18-23(29(35)30(36)37)11-14-28(27)38-20-24;1-2/h6,8,11-14,17-18,24,29,35H,4-5,7,9-10,15-16,19-20H2,1-3H3,(H,36,37);1-2H3/b8-6+; |
| InChIKey | DRXCWESVJQRJRE-WVLIHFOGSA-N |
| XLogP | 6.62 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.17 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|