C33H49ClN2O4 — CID 153341369
N-[(E)-7-[3-(4-chloro-2-propylphenyl)-7-methyl-3,4-dihydro-2H-1,5-benzoxazepin-5-yl]hept-2-enyl]-N-methylpropanamide;ethane;formic acid (PubChem CID 153341369) has the molecular formula C33H49ClN2O4 and a molecular weight of 573.22 g/mol. Its IUPAC name is N-[(E)-7-[3-(4-chloro-2-propylphenyl)-7-methyl-3,4-dihydro-2H-1,5-benzoxazepin-5-yl]hept-2-enyl]-N-methylpropanamide;ethane;formic acid.
| Compound Name | N-[(E)-7-[3-(4-chloro-2-propylphenyl)-7-methyl-3,4-dihydro-2H-1,5-benzoxazepin-5-yl]hept-2-enyl]-N-methylpropanamide;ethane;formic acid |
|---|---|
| PubChem CID | 153341369 |
| Molecular Formula | C33H49ClN2O4 |
| Molecular Weight | 573.22 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | N-[(E)-7-[3-(4-chloro-2-propylphenyl)-7-methyl-3,4-dihydro-2H-1,5-benzoxazepin-5-yl]hept-2-enyl]-N-methylpropanamide;ethane;formic acid |
| SMILES | CC.CCCc1cc(Cl)ccc1C1COc2ccc(C)cc2N(CCCC/C=C/CN(C)C(=O)CC)C1.O=CO |
| InChI | InChI=1S/C30H41ClN2O2.C2H6.CH2O2/c1-5-12-24-20-26(31)14-15-27(24)25-21-33(28-19-23(3)13-16-29(28)35-22-25)18-11-9-7-8-10-17-32(4)30(34)6-2;1-2;2-1-3/h8,10,13-16,19-20,25H,5-7,9,11-12,17-18,21-22H2,1-4H3;1-2H3;1H,(H,2,3)/b10-8+;; |
| InChIKey | GXMRNWAJPBLQQC-PIHABLKOSA-N |
| XLogP | 7.91 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.22 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|