C22H28N2O2 — CID 167300914
6-[2-[(3aS,6aR)-5-benzyl-5-methoxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]ethyl]pyridin-3-ol (PubChem CID 167300914) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 6-[2-[(3aS,6aR)-5-benzyl-5-methoxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]ethyl]pyridin-3-ol.
| Compound Name | 6-[2-[(3aS,6aR)-5-benzyl-5-methoxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]ethyl]pyridin-3-ol |
|---|---|
| PubChem CID | 167300914 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 6-[2-[(3aS,6aR)-5-benzyl-5-methoxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]ethyl]pyridin-3-ol |
| SMILES | COC1(Cc2ccccc2)C[C@H]2CN(CCc3ccc(O)cn3)C[C@H]2C1 |
| InChI | InChI=1S/C22H28N2O2/c1-26-22(11-17-5-3-2-4-6-17)12-18-15-24(16-19(18)13-22)10-9-20-7-8-21(25)14-23-20/h2-8,14,18-19,25H,9-13,15-16H2,1H3/t18-,19+,22? |
| InChIKey | OHBUPNPRIKZQSE-QIDMFYOTSA-N |
| XLogP | 3.30 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |