C30H31N5O4 — CID 167303190
3-[3-oxo-6-[(1S,2R)-2-(3-quinoxalin-2-ylazetidin-1-yl)cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167303190) has the molecular formula C30H31N5O4 and a molecular weight of 525.61 g/mol. Its IUPAC name is 3-[3-oxo-6-[(1S,2R)-2-(3-quinoxalin-2-ylazetidin-1-yl)cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[(1S,2R)-2-(3-quinoxalin-2-ylazetidin-1-yl)cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167303190 |
| Molecular Formula | C30H31N5O4 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | 3-[3-oxo-6-[(1S,2R)-2-(3-quinoxalin-2-ylazetidin-1-yl)cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(O[C@H]4CCCC[C@H]4N4CC(c5cnc6ccccc6n5)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H31N5O4/c36-28-12-11-26(29(37)33-28)35-17-18-13-20(9-10-21(18)30(35)38)39-27-8-4-3-7-25(27)34-15-19(16-34)24-14-31-22-5-1-2-6-23(22)32-24/h1-2,5-6,9-10,13-14,19,25-27H,3-4,7-8,11-12,15-17H2,(H,33,36,37)/t25-,26?,27+/m1/s1 |
| InChIKey | AVBUTLBHHGZDRC-HXMJJLHYSA-N |
| XLogP | 3.18 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|