C29H51N9O — CID 167304870
3-[[5-(1,3-diazinan-4-yl)-4-[(1R,3S)-3-(methylamino)cyclohexyl]-1,2,4-triazolidin-3-yl]methylamino]-N-[(3-ethylpiperidin-4-yl)methyl]benzamide (PubChem CID 167304870) has the molecular formula C29H51N9O and a molecular weight of 541.79 g/mol. Its IUPAC name is 3-[[5-(1,3-diazinan-4-yl)-4-[(1R,3S)-3-(methylamino)cyclohexyl]-1,2,4-triazolidin-3-yl]methylamino]-N-[(3-ethylpiperidin-4-yl)methyl]benzamide.
| Compound Name | 3-[[5-(1,3-diazinan-4-yl)-4-[(1R,3S)-3-(methylamino)cyclohexyl]-1,2,4-triazolidin-3-yl]methylamino]-N-[(3-ethylpiperidin-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 167304870 |
| Molecular Formula | C29H51N9O |
| Molecular Weight | 541.79 g/mol |
| Exact Mass | 541.42 |
| IUPAC Name | 3-[[5-(1,3-diazinan-4-yl)-4-[(1R,3S)-3-(methylamino)cyclohexyl]-1,2,4-triazolidin-3-yl]methylamino]-N-[(3-ethylpiperidin-4-yl)methyl]benzamide |
| SMILES | CCC1CNCCC1CNC(=O)c1cccc(NCC2NNC(C3CCNCN3)N2[C@@H]2CCC[C@H](NC)C2)c1 |
| InChI | InChI=1S/C29H51N9O/c1-3-20-16-31-12-10-22(20)17-34-29(39)21-6-4-8-24(14-21)33-18-27-36-37-28(26-11-13-32-19-35-26)38(27)25-9-5-7-23(15-25)30-2/h4,6,8,14,20,22-23,25-28,30-33,35-37H,3,5,7,9-13,15-19H2,1-2H3,(H,34,39)/t20?,22?,23-,25+,26?,27?,28?/m0/s1 |
| InChIKey | FBKRNCWNABRGII-XWQISCGSSA-N |
| XLogP | 0.97 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.79 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |