C25H40N8O2 — CID 166874838
N-(1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-3-ylmethyl)-3-(9-oxa-3,4,6,12-tetrazatricyclo[8.4.0.02,6]tetradecan-5-ylmethylamino)benzamide (PubChem CID 166874838) has the molecular formula C25H40N8O2 and a molecular weight of 484.65 g/mol. Its IUPAC name is N-(1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-3-ylmethyl)-3-(9-oxa-3,4,6,12-tetrazatricyclo[8.4.0.02,6]tetradecan-5-ylmethylamino)benzamide.
| Compound Name | N-(1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-3-ylmethyl)-3-(9-oxa-3,4,6,12-tetrazatricyclo[8.4.0.02,6]tetradecan-5-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 166874838 |
| Molecular Formula | C25H40N8O2 |
| Molecular Weight | 484.65 g/mol |
| Exact Mass | 484.33 |
| IUPAC Name | N-(1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-3-ylmethyl)-3-(9-oxa-3,4,6,12-tetrazatricyclo[8.4.0.02,6]tetradecan-5-ylmethylamino)benzamide |
| SMILES | O=C(NCC1CNC2CCCCN12)c1cccc(NCC2NNC3C4CCNCC4OCCN23)c1 |
| InChI | InChI=1S/C25H40N8O2/c34-25(29-14-19-13-28-22-6-1-2-9-32(19)22)17-4-3-5-18(12-17)27-16-23-30-31-24-20-7-8-26-15-21(20)35-11-10-33(23)24/h3-5,12,19-24,26-28,30-31H,1-2,6-11,13-16H2,(H,29,34) |
| InChIKey | ZIHWCPSKVVKKRB-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.65 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |