C14H16N2O2 — CID 167305081
(2S)-2-(methylamino)-3-(naphthalen-2-ylamino)propanoic acid (PubChem CID 167305081) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is (2S)-2-(methylamino)-3-(naphthalen-2-ylamino)propanoic acid.
| Compound Name | (2S)-2-(methylamino)-3-(naphthalen-2-ylamino)propanoic acid |
|---|---|
| PubChem CID | 167305081 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (2S)-2-(methylamino)-3-(naphthalen-2-ylamino)propanoic acid |
| SMILES | CN[C@@H](CNc1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C14H16N2O2/c1-15-13(14(17)18)9-16-12-7-6-10-4-2-3-5-11(10)8-12/h2-8,13,15-16H,9H2,1H3,(H,17,18)/t13-/m0/s1 |
| InChIKey | YZANUDAVNVQRMM-ZDUSSCGKSA-N |
| XLogP | 1.92 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |