C24H25N3O3S — CID 16730886
[4-[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]piperazin-1-yl]-thiophen-2-ylmethanone (PubChem CID 16730886) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is [4-[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]piperazin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]piperazin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 16730886 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | [4-[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]piperazin-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCN(CC(O)COc2cccc3[nH]c4ccccc4c23)CC1 |
| InChI | InChI=1S/C24H25N3O3S/c28-17(15-26-10-12-27(13-11-26)24(29)22-9-4-14-31-22)16-30-21-8-3-7-20-23(21)18-5-1-2-6-19(18)25-20/h1-9,14,17,25,28H,10-13,15-16H2 |
| InChIKey | JBWGWPUPQMVMJA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |