C21H26N2O5S — CID 55462369
ethyl 4-[2-hydroxy-3-[4-(thiophene-2-carbonyl)piperazin-1-yl]propoxy]benzoate (PubChem CID 55462369) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is ethyl 4-[2-hydroxy-3-[4-(thiophene-2-carbonyl)piperazin-1-yl]propoxy]benzoate.
| Compound Name | ethyl 4-[2-hydroxy-3-[4-(thiophene-2-carbonyl)piperazin-1-yl]propoxy]benzoate |
|---|---|
| PubChem CID | 55462369 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | ethyl 4-[2-hydroxy-3-[4-(thiophene-2-carbonyl)piperazin-1-yl]propoxy]benzoate |
| SMILES | CCOC(=O)c1ccc(OCC(O)CN2CCN(C(=O)c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C21H26N2O5S/c1-2-27-21(26)16-5-7-18(8-6-16)28-15-17(24)14-22-9-11-23(12-10-22)20(25)19-4-3-13-29-19/h3-8,13,17,24H,2,9-12,14-15H2,1H3 |
| InChIKey | QOIDTXBQTCPWIZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |