C16H22N2O5 — CID 18125623
ethyl 4-[2-hydroxy-3-(3-oxopiperazin-1-yl)propoxy]benzoate (PubChem CID 18125623) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is ethyl 4-[2-hydroxy-3-(3-oxopiperazin-1-yl)propoxy]benzoate.
| Compound Name | ethyl 4-[2-hydroxy-3-(3-oxopiperazin-1-yl)propoxy]benzoate |
|---|---|
| PubChem CID | 18125623 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | ethyl 4-[2-hydroxy-3-(3-oxopiperazin-1-yl)propoxy]benzoate |
| SMILES | CCOC(=O)c1ccc(OCC(O)CN2CCNC(=O)C2)cc1 |
| InChI | InChI=1S/C16H22N2O5/c1-2-22-16(21)12-3-5-14(6-4-12)23-11-13(19)9-18-8-7-17-15(20)10-18/h3-6,13,19H,2,7-11H2,1H3,(H,17,20) |
| InChIKey | QMMRGJAZJJRJGC-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |