C12H16N2O — CID 167309053
7-methyl-3-oxa-7-azatricyclo[7.3.1.05,13]trideca-1(12),9(13),10-trien-11-amine (PubChem CID 167309053) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 7-methyl-3-oxa-7-azatricyclo[7.3.1.05,13]trideca-1(12),9(13),10-trien-11-amine.
| Compound Name | 7-methyl-3-oxa-7-azatricyclo[7.3.1.05,13]trideca-1(12),9(13),10-trien-11-amine |
|---|---|
| PubChem CID | 167309053 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 7-methyl-3-oxa-7-azatricyclo[7.3.1.05,13]trideca-1(12),9(13),10-trien-11-amine |
| SMILES | CN1Cc2cc(N)cc3c2C(COC3)C1 |
| InChI | InChI=1S/C12H16N2O/c1-14-4-8-2-11(13)3-9-6-15-7-10(5-14)12(8)9/h2-3,10H,4-7,13H2,1H3 |
| InChIKey | MNWYFLZXOIFXNY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|