C13H19N3 — CID 167309208
2-methyl-1,3,3a,4,5,6-hexahydrobenzo[de]isoquinoline-4,8-diamine (PubChem CID 167309208) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 2-methyl-1,3,3a,4,5,6-hexahydrobenzo[de]isoquinoline-4,8-diamine.
| Compound Name | 2-methyl-1,3,3a,4,5,6-hexahydrobenzo[de]isoquinoline-4,8-diamine |
|---|---|
| PubChem CID | 167309208 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 2-methyl-1,3,3a,4,5,6-hexahydrobenzo[de]isoquinoline-4,8-diamine |
| SMILES | CN1Cc2cc(N)cc3c2C(C1)C(N)CC3 |
| InChI | InChI=1S/C13H19N3/c1-16-6-9-5-10(14)4-8-2-3-12(15)11(7-16)13(8)9/h4-5,11-12H,2-3,6-7,14-15H2,1H3 |
| InChIKey | JJQCITYKELTSMQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|