C22H18N2O2S — CID 16730934
3-(3,4-dimethylbenzoyl)-1-(1,3-thiazol-4-ylmethyl)quinolin-4-one (PubChem CID 16730934) has the molecular formula C22H18N2O2S and a molecular weight of 374.47 g/mol. Its IUPAC name is 3-(3,4-dimethylbenzoyl)-1-(1,3-thiazol-4-ylmethyl)quinolin-4-one.
| Compound Name | 3-(3,4-dimethylbenzoyl)-1-(1,3-thiazol-4-ylmethyl)quinolin-4-one |
|---|---|
| PubChem CID | 16730934 |
| Molecular Formula | C22H18N2O2S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 3-(3,4-dimethylbenzoyl)-1-(1,3-thiazol-4-ylmethyl)quinolin-4-one |
| SMILES | Cc1ccc(C(=O)c2cn(Cc3cscn3)c3ccccc3c2=O)cc1C |
| InChI | InChI=1S/C22H18N2O2S/c1-14-7-8-16(9-15(14)2)21(25)19-11-24(10-17-12-27-13-23-17)20-6-4-3-5-18(20)22(19)26/h3-9,11-13H,10H2,1-2H3 |
| InChIKey | ZCEIILGTPFBZEE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |