C24H25F3N2O2 — CID 167310846
1-[3-[[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]methyl]azetidin-1-yl]-6-hydroxyhexan-1-one (PubChem CID 167310846) has the molecular formula C24H25F3N2O2 and a molecular weight of 430.47 g/mol. Its IUPAC name is 1-[3-[[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]methyl]azetidin-1-yl]-6-hydroxyhexan-1-one.
| Compound Name | 1-[3-[[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]methyl]azetidin-1-yl]-6-hydroxyhexan-1-one |
|---|---|
| PubChem CID | 167310846 |
| Molecular Formula | C24H25F3N2O2 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 1-[3-[[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]methyl]azetidin-1-yl]-6-hydroxyhexan-1-one |
| SMILES | O=C(CCCCCO)N1CC(Cc2c(-c3ccc(F)cc3)[nH]c3c(F)cc(F)cc23)C1 |
| InChI | InChI=1S/C24H25F3N2O2/c25-17-7-5-16(6-8-17)23-19(20-11-18(26)12-21(27)24(20)28-23)10-15-13-29(14-15)22(31)4-2-1-3-9-30/h5-8,11-12,15,28,30H,1-4,9-10,13-14H2 |
| InChIKey | STQUVXKQCWUBGN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|