About 3-(cyclobutylmethyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole
3-(cyclobutylmethyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole (PubChem CID 156815770) has the molecular formula C19H16F3N
and a molecular weight of 315.34 g/mol. Its IUPAC name is 3-(cyclobutylmethyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole.
Molecular Properties
| Compound Name | 3-(cyclobutylmethyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole |
| PubChem CID | 156815770 |
| Molecular Formula | C19H16F3N |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 3-(cyclobutylmethyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole |
| SMILES | Fc1ccc(-c2[nH]c3c(F)cc(F)cc3c2CC2CCC2)cc1 |
| InChI | InChI=1S/C19H16F3N/c20-13-6-4-12(5-7-13)18-15(8-11-2-1-3-11)16-9-14(21)10-17(22)19(16)23-18/h4-7,9-11,23H,1-3,8H2 |
| InChIKey | QYLRYNUWGWIVJR-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-(cyclobutylmethyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclobutylmethyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole?
The IUPAC name of 3-(cyclobutylmethyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole (CID 156815770) is 3-(cyclobutylmethyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole.
What is the SMILES notation for 3-(cyclobutylmethyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole?
The canonical SMILES for 3-(cyclobutylmethyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole is Fc1ccc(-c2[nH]c3c(F)cc(F)cc3c2CC2CCC2)cc1.
What is the InChIKey of 3-(cyclobutylmethyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole?
The InChIKey is QYLRYNUWGWIVJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F3N/c20-13-6-4-12(5-7-13)18-15(8-11-2-1-3-11)16-9-14(21)10-17(22)19(16)23-18/h4-7,9-11,23H,1-3,8H2.
What are the key properties of 3-(cyclobutylmethyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole?
3-(cyclobutylmethyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole has a molecular weight of 315.34 g/mol, XLogP of 5.59, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclobutylmethyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole is sourced from PubChem (CID 156815770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).