C18H32OSi — CID 167311432
[(4R)-4-ethenyl-4,6,6-trimethyl-2-bicyclo[3.1.1]hept-2-enyl]oxy-triethylsilane (PubChem CID 167311432) has the molecular formula C18H32OSi and a molecular weight of 292.54 g/mol. Its IUPAC name is [(4R)-4-ethenyl-4,6,6-trimethyl-2-bicyclo[3.1.1]hept-2-enyl]oxy-triethylsilane.
| Compound Name | [(4R)-4-ethenyl-4,6,6-trimethyl-2-bicyclo[3.1.1]hept-2-enyl]oxy-triethylsilane |
|---|---|
| PubChem CID | 167311432 |
| Molecular Formula | C18H32OSi |
| Molecular Weight | 292.54 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | [(4R)-4-ethenyl-4,6,6-trimethyl-2-bicyclo[3.1.1]hept-2-enyl]oxy-triethylsilane |
| SMILES | C=C[C@@]1(C)C=C(O[Si](CC)(CC)CC)C2CC1C2(C)C |
| InChI | InChI=1S/C18H32OSi/c1-8-18(7)13-15(14-12-16(18)17(14,5)6)19-20(9-2,10-3)11-4/h8,13-14,16H,1,9-12H2,2-7H3/t14?,16?,18-/m0/s1 |
| InChIKey | ZQCMTFUKFBUSFI-PVARCSIZSA-N |
| XLogP | 5.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.54 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|