C33H52N2O5Si — CID 167319460
[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] (2S)-2-(hexylamino)propanoate (PubChem CID 167319460) has the molecular formula C33H52N2O5Si and a molecular weight of 584.87 g/mol. Its IUPAC name is [(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] (2S)-2-(hexylamino)propanoate.
| Compound Name | [(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] (2S)-2-(hexylamino)propanoate |
|---|---|
| PubChem CID | 167319460 |
| Molecular Formula | C33H52N2O5Si |
| Molecular Weight | 584.87 g/mol |
| Exact Mass | 584.36 |
| IUPAC Name | [(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] (2S)-2-(hexylamino)propanoate |
| SMILES | CCCCCCN[C@@H](C)C(=O)OC[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H52N2O5Si/c1-9-10-11-18-23-34-26(2)30(36)38-24-27(35-31(37)40-32(3,4)5)25-39-41(33(6,7)8,28-19-14-12-15-20-28)29-21-16-13-17-22-29/h12-17,19-22,26-27,34H,9-11,18,23-25H2,1-8H3,(H,35,37)/t26-,27-/m0/s1 |
| InChIKey | QRTBMZKDFCYCNI-SVBPBHIXSA-N |
| XLogP | 5.56 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.87 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|