C8H18N2O2S — CID 167322847
(E)-3-(dimethylamino)-N-propan-2-ylprop-1-ene-1-sulfonamide (PubChem CID 167322847) has the molecular formula C8H18N2O2S and a molecular weight of 206.31 g/mol. Its IUPAC name is (E)-3-(dimethylamino)-N-propan-2-ylprop-1-ene-1-sulfonamide.
| Compound Name | (E)-3-(dimethylamino)-N-propan-2-ylprop-1-ene-1-sulfonamide |
|---|---|
| PubChem CID | 167322847 |
| Molecular Formula | C8H18N2O2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (E)-3-(dimethylamino)-N-propan-2-ylprop-1-ene-1-sulfonamide |
| SMILES | CC(C)NS(=O)(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C8H18N2O2S/c1-8(2)9-13(11,12)7-5-6-10(3)4/h5,7-9H,6H2,1-4H3/b7-5+ |
| InChIKey | GOZVKJXYVUOPLA-FNORWQNLSA-N |
| XLogP | 0.39 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |