C62H46N2 — CID 167334118
2,3,4,5,6,7,8-heptadeuterio-N-[4-[9,9-dimethyl-2-(9-phenylfluoren-9-yl)acridin-10-yl]phenyl]-N-(4-phenylphenyl)naphthalen-1-amine (PubChem CID 167334118) has the molecular formula C62H46N2 and a molecular weight of 826.11 g/mol. Its IUPAC name is 2,3,4,5,6,7,8-heptadeuterio-N-[4-[9,9-dimethyl-2-(9-phenylfluoren-9-yl)acridin-10-yl]phenyl]-N-(4-phenylphenyl)naphthalen-1-amine.
| Compound Name | 2,3,4,5,6,7,8-heptadeuterio-N-[4-[9,9-dimethyl-2-(9-phenylfluoren-9-yl)acridin-10-yl]phenyl]-N-(4-phenylphenyl)naphthalen-1-amine |
|---|---|
| PubChem CID | 167334118 |
| Molecular Formula | C62H46N2 |
| Molecular Weight | 826.11 g/mol |
| Exact Mass | 825.41 |
| IUPAC Name | 2,3,4,5,6,7,8-heptadeuterio-N-[4-[9,9-dimethyl-2-(9-phenylfluoren-9-yl)acridin-10-yl]phenyl]-N-(4-phenylphenyl)naphthalen-1-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(N(c3ccc(-c4ccccc4)cc3)c3ccc(N4c5ccccc5C(C)(C)c5cc(C6(c7ccccc7)c7ccccc7-c7ccccc76)ccc54)cc3)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C62H46N2/c1-61(2)56-29-15-16-30-59(56)64(60-41-34-47(42-57(60)61)62(46-22-7-4-8-23-46)54-27-13-11-25-52(54)53-26-12-14-28-55(53)62)50-39-37-49(38-40-50)63(58-31-17-21-45-20-9-10-24-51(45)58)48-35-32-44(33-36-48)43-18-5-3-6-19-43/h3-42H,1-2H3/i9D,10D,17D,20D,21D,24D,31D |
| InChIKey | FSPUMSGYCVOVJS-QGWYIOHISA-N |
| XLogP | 16.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.11 |
| LogP ≤ 5 | 16.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |