C16H33N2O6+ — CID 167334566
[3-[[(3S,4R,6S)-5-acetamido-4-hydroxy-3-methoxy-6-methyloxan-2-yl]methoxy]-2-hydroxypropyl]-trimethylazanium (PubChem CID 167334566) has the molecular formula C16H33N2O6+ and a molecular weight of 349.45 g/mol. Its IUPAC name is [3-[[(3S,4R,6S)-5-acetamido-4-hydroxy-3-methoxy-6-methyloxan-2-yl]methoxy]-2-hydroxypropyl]-trimethylazanium.
| Compound Name | [3-[[(3S,4R,6S)-5-acetamido-4-hydroxy-3-methoxy-6-methyloxan-2-yl]methoxy]-2-hydroxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 167334566 |
| Molecular Formula | C16H33N2O6+ |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | [3-[[(3S,4R,6S)-5-acetamido-4-hydroxy-3-methoxy-6-methyloxan-2-yl]methoxy]-2-hydroxypropyl]-trimethylazanium |
| SMILES | CO[C@@H]1C(COCC(O)C[N+](C)(C)C)O[C@@H](C)C(NC(C)=O)[C@H]1O |
| InChI | InChI=1S/C16H32N2O6/c1-10-14(17-11(2)19)15(21)16(22-6)13(24-10)9-23-8-12(20)7-18(3,4)5/h10,12-16,20-21H,7-9H2,1-6H3/p+1/t10-,12?,13?,14?,15+,16+/m0/s1 |
| InChIKey | DSCCTOQMOARRRO-ZFPHHBSHSA-O |
| XLogP | -1.26 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|