C16H15NO6 — CID 167335077
2-[2-[2-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxyethylamino]ethoxy]cyclohexa-2,5-diene-1,4-dione (PubChem CID 167335077) has the molecular formula C16H15NO6 and a molecular weight of 317.30 g/mol. Its IUPAC name is 2-[2-[2-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxyethylamino]ethoxy]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[2-[2-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxyethylamino]ethoxy]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 167335077 |
| Molecular Formula | C16H15NO6 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 2-[2-[2-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxyethylamino]ethoxy]cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=CC(=O)C(OCCNCCOC2=CC(=O)C=CC2=O)=C1 |
| InChI | InChI=1S/C16H15NO6/c18-11-1-3-13(20)15(9-11)22-7-5-17-6-8-23-16-10-12(19)2-4-14(16)21/h1-4,9-10,17H,5-8H2 |
| InChIKey | WWKXDRMHWPIZLW-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|