C16H16NO6+ — CID 167335076
bis[2-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxyethyl]azanium (PubChem CID 167335076) has the molecular formula C16H16NO6+ and a molecular weight of 318.31 g/mol. Its IUPAC name is bis[2-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxyethyl]azanium.
| Compound Name | bis[2-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxyethyl]azanium |
|---|---|
| PubChem CID | 167335076 |
| Molecular Formula | C16H16NO6+ |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | bis[2-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxyethyl]azanium |
| SMILES | O=C1C=CC(=O)C(OCC[NH2+]CCOC2=CC(=O)C=CC2=O)=C1 |
| InChI | InChI=1S/C16H15NO6/c18-11-1-3-13(20)15(9-11)22-7-5-17-6-8-23-16-10-12(19)2-4-14(16)21/h1-4,9-10,17H,5-8H2/p+1 |
| InChIKey | WWKXDRMHWPIZLW-UHFFFAOYSA-O |
| XLogP | -1.23 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|