C29H30FeN7O7+ — CID 167335531
2-[bis[2-(5-methoxycarbonylpyridine-2-carbonyl)azanidylethyl]amino]ethyl-(5-methylpyridine-2-carbonyl)azanide;iron(4+) (PubChem CID 167335531) has the molecular formula C29H30FeN7O7+ and a molecular weight of 644.45 g/mol. Its IUPAC name is 2-[bis[2-(5-methoxycarbonylpyridine-2-carbonyl)azanidylethyl]amino]ethyl-(5-methylpyridine-2-carbonyl)azanide;iron(4+).
| Compound Name | 2-[bis[2-(5-methoxycarbonylpyridine-2-carbonyl)azanidylethyl]amino]ethyl-(5-methylpyridine-2-carbonyl)azanide;iron(4+) |
|---|---|
| PubChem CID | 167335531 |
| Molecular Formula | C29H30FeN7O7+ |
| Molecular Weight | 644.45 g/mol |
| Exact Mass | 644.16 |
| IUPAC Name | 2-[bis[2-(5-methoxycarbonylpyridine-2-carbonyl)azanidylethyl]amino]ethyl-(5-methylpyridine-2-carbonyl)azanide;iron(4+) |
| SMILES | COC(=O)c1ccc(C(=O)[N-]CCN(CC[N-]C(=O)c2ccc(C)cn2)CC[N-]C(=O)c2ccc(C(=O)OC)cn2)nc1.[Fe+4] |
| InChI | InChI=1S/C29H33N7O7.Fe/c1-19-4-7-22(33-16-19)25(37)30-10-13-36(14-11-31-26(38)23-8-5-20(17-34-23)28(40)42-2)15-12-32-27(39)24-9-6-21(18-35-24)29(41)43-3;/h4-9,16-18H,10-15H2,1-3H3,(H3,30,31,32,37,38,39);/q;+4/p-3 |
| InChIKey | ASMVMHVEHODATJ-UHFFFAOYSA-K |
| XLogP | 2.99 |
| TPSA | 188.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|