C52H31N3 — CID 167336401
3-[3-(3-carbazol-9-ylphenyl)-5-isocyanophenyl]-5-(10-phenylanthracen-9-yl)benzonitrile (PubChem CID 167336401) has the molecular formula C52H31N3 and a molecular weight of 697.84 g/mol. Its IUPAC name is 3-[3-(3-carbazol-9-ylphenyl)-5-isocyanophenyl]-5-(10-phenylanthracen-9-yl)benzonitrile.
| Compound Name | 3-[3-(3-carbazol-9-ylphenyl)-5-isocyanophenyl]-5-(10-phenylanthracen-9-yl)benzonitrile |
|---|---|
| PubChem CID | 167336401 |
| Molecular Formula | C52H31N3 |
| Molecular Weight | 697.84 g/mol |
| Exact Mass | 697.25 |
| IUPAC Name | 3-[3-(3-carbazol-9-ylphenyl)-5-isocyanophenyl]-5-(10-phenylanthracen-9-yl)benzonitrile |
| SMILES | [C-]#[N+]c1cc(-c2cc(C#N)cc(-c3c4ccccc4c(-c4ccccc4)c4ccccc34)c2)cc(-c2cccc(-n3c4ccccc4c4ccccc43)c2)c1 |
| InChI | InChI=1S/C52H31N3/c1-54-41-30-38(36-16-13-17-42(32-36)55-49-24-11-9-18-43(49)44-19-10-12-25-50(44)55)28-39(31-41)37-26-34(33-53)27-40(29-37)52-47-22-7-5-20-45(47)51(35-14-3-2-4-15-35)46-21-6-8-23-48(46)52/h2-32H |
| InChIKey | ZKDISEKNDRCCFH-UHFFFAOYSA-N |
| XLogP | 14.18 |
| TPSA | 33.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.84 |
| LogP ≤ 5 | 14.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|