C4H4F2N2OS2 — CID 167336921
2-(difluoromethyl)-1,3-thiazole-5-sulfinamide (PubChem CID 167336921) has the molecular formula C4H4F2N2OS2 and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-(difluoromethyl)-1,3-thiazole-5-sulfinamide.
| Compound Name | 2-(difluoromethyl)-1,3-thiazole-5-sulfinamide |
|---|---|
| PubChem CID | 167336921 |
| Molecular Formula | C4H4F2N2OS2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 197.97 |
| IUPAC Name | 2-(difluoromethyl)-1,3-thiazole-5-sulfinamide |
| SMILES | NS(=O)c1cnc(C(F)F)s1 |
| InChI | InChI=1S/C4H4F2N2OS2/c5-3(6)4-8-1-2(10-4)11(7)9/h1,3H,7H2 |
| InChIKey | MSKXDRXIUHRCTE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |