C21H25Cl2N3O3S — CID 167339679
N-[2,3-dichloro-4-(1-piperidin-4-ylethylsulfamoyl)phenyl]-2-methylbenzamide (PubChem CID 167339679) has the molecular formula C21H25Cl2N3O3S and a molecular weight of 470.42 g/mol. Its IUPAC name is N-[2,3-dichloro-4-(1-piperidin-4-ylethylsulfamoyl)phenyl]-2-methylbenzamide.
| Compound Name | N-[2,3-dichloro-4-(1-piperidin-4-ylethylsulfamoyl)phenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 167339679 |
| Molecular Formula | C21H25Cl2N3O3S |
| Molecular Weight | 470.42 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | N-[2,3-dichloro-4-(1-piperidin-4-ylethylsulfamoyl)phenyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(S(=O)(=O)NC(C)C2CCNCC2)c(Cl)c1Cl |
| InChI | InChI=1S/C21H25Cl2N3O3S/c1-13-5-3-4-6-16(13)21(27)25-17-7-8-18(20(23)19(17)22)30(28,29)26-14(2)15-9-11-24-12-10-15/h3-8,14-15,24,26H,9-12H2,1-2H3,(H,25,27) |
| InChIKey | OURKTHCTLRNKRA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |