C24H34N3O3S+ — CID 167339725
N-[4-[[(1R)-1-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl]sulfamoyl]-2-methylphenyl]-2-methylbenzamide (PubChem CID 167339725) has the molecular formula C24H34N3O3S+ and a molecular weight of 444.62 g/mol. Its IUPAC name is N-[4-[[(1R)-1-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl]sulfamoyl]-2-methylphenyl]-2-methylbenzamide.
| Compound Name | N-[4-[[(1R)-1-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl]sulfamoyl]-2-methylphenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 167339725 |
| Molecular Formula | C24H34N3O3S+ |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | N-[4-[[(1R)-1-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl]sulfamoyl]-2-methylphenyl]-2-methylbenzamide |
| SMILES | Cc1cc(S(=O)(=O)N[C@H](C)C2CC[N+](C)(C)CC2)ccc1NC(=O)c1ccccc1C |
| InChI | InChI=1S/C24H33N3O3S/c1-17-8-6-7-9-22(17)24(28)25-23-11-10-21(16-18(23)2)31(29,30)26-19(3)20-12-14-27(4,5)15-13-20/h6-11,16,19-20,26H,12-15H2,1-5H3/p+1/t19-/m1/s1 |
| InChIKey | TUQKZYXAFHVETI-LJQANCHMSA-O |
| XLogP | 3.71 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|