C23H37N3O3S — CID 167339683
N-[2-methyl-4-[1-(1-methylpiperidin-4-yl)ethylsulfamoyl]phenyl]cycloheptanecarboxamide (PubChem CID 167339683) has the molecular formula C23H37N3O3S and a molecular weight of 435.63 g/mol. Its IUPAC name is N-[2-methyl-4-[1-(1-methylpiperidin-4-yl)ethylsulfamoyl]phenyl]cycloheptanecarboxamide.
| Compound Name | N-[2-methyl-4-[1-(1-methylpiperidin-4-yl)ethylsulfamoyl]phenyl]cycloheptanecarboxamide |
|---|---|
| PubChem CID | 167339683 |
| Molecular Formula | C23H37N3O3S |
| Molecular Weight | 435.63 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | N-[2-methyl-4-[1-(1-methylpiperidin-4-yl)ethylsulfamoyl]phenyl]cycloheptanecarboxamide |
| SMILES | Cc1cc(S(=O)(=O)NC(C)C2CCN(C)CC2)ccc1NC(=O)C1CCCCCC1 |
| InChI | InChI=1S/C23H37N3O3S/c1-17-16-21(30(28,29)25-18(2)19-12-14-26(3)15-13-19)10-11-22(17)24-23(27)20-8-6-4-5-7-9-20/h10-11,16,18-20,25H,4-9,12-15H2,1-3H3,(H,24,27) |
| InChIKey | YMXGGZBLZCJYIK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.63 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |