About 1,4-difluoro-2-[(1S,2R)-2-propan-2-ylcyclopropyl]benzene
1,4-difluoro-2-[(1S,2R)-2-propan-2-ylcyclopropyl]benzene (PubChem CID 167340119) has the molecular formula C12H14F2
and a molecular weight of 196.24 g/mol. Its IUPAC name is 1,4-difluoro-2-[(1S,2R)-2-propan-2-ylcyclopropyl]benzene.
Molecular Properties
| Compound Name | 1,4-difluoro-2-[(1S,2R)-2-propan-2-ylcyclopropyl]benzene |
| PubChem CID | 167340119 |
| Molecular Formula | C12H14F2 |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 1,4-difluoro-2-[(1S,2R)-2-propan-2-ylcyclopropyl]benzene |
| SMILES | CC(C)[C@H]1C[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C12H14F2/c1-7(2)9-6-10(9)11-5-8(13)3-4-12(11)14/h3-5,7,9-10H,6H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | DLLATSFRCKXFFS-ZJUUUORDSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,4-difluoro-2-[(1S,2R)-2-propan-2-ylcyclopropyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-difluoro-2-[(1S,2R)-2-propan-2-ylcyclopropyl]benzene?
The IUPAC name of 1,4-difluoro-2-[(1S,2R)-2-propan-2-ylcyclopropyl]benzene (CID 167340119) is 1,4-difluoro-2-[(1S,2R)-2-propan-2-ylcyclopropyl]benzene.
What is the SMILES notation for 1,4-difluoro-2-[(1S,2R)-2-propan-2-ylcyclopropyl]benzene?
The canonical SMILES for 1,4-difluoro-2-[(1S,2R)-2-propan-2-ylcyclopropyl]benzene is CC(C)[C@H]1C[C@@H]1c1cc(F)ccc1F.
What is the InChIKey of 1,4-difluoro-2-[(1S,2R)-2-propan-2-ylcyclopropyl]benzene?
The InChIKey is DLLATSFRCKXFFS-ZJUUUORDSA-N. The full InChI is InChI=1S/C12H14F2/c1-7(2)9-6-10(9)11-5-8(13)3-4-12(11)14/h3-5,7,9-10H,6H2,1-2H3/t9-,10+/m1/s1.
What are the key properties of 1,4-difluoro-2-[(1S,2R)-2-propan-2-ylcyclopropyl]benzene?
1,4-difluoro-2-[(1S,2R)-2-propan-2-ylcyclopropyl]benzene has a molecular weight of 196.24 g/mol, XLogP of 3.72, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-difluoro-2-[(1S,2R)-2-propan-2-ylcyclopropyl]benzene is sourced from PubChem (CID 167340119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).