C12H14F2 — CID 167340119
1,4-difluoro-2-[(1S,2R)-2-propan-2-ylcyclopropyl]benzene (PubChem CID 167340119) has the molecular formula C12H14F2 and a molecular weight of 196.24 g/mol. Its IUPAC name is 1,4-difluoro-2-[(1S,2R)-2-propan-2-ylcyclopropyl]benzene.
| Compound Name | 1,4-difluoro-2-[(1S,2R)-2-propan-2-ylcyclopropyl]benzene |
|---|---|
| PubChem CID | 167340119 |
| Molecular Formula | C12H14F2 |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 1,4-difluoro-2-[(1S,2R)-2-propan-2-ylcyclopropyl]benzene |
| SMILES | CC(C)[C@H]1C[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C12H14F2/c1-7(2)9-6-10(9)11-5-8(13)3-4-12(11)14/h3-5,7,9-10H,6H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | DLLATSFRCKXFFS-ZJUUUORDSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |