C11H13F2N — CID 29079347
(1S)-1-[(1S,2S)-2-(2,4-difluorophenyl)cyclopropyl]ethanamine (PubChem CID 29079347) has the molecular formula C11H13F2N and a molecular weight of 197.23 g/mol. Its IUPAC name is (1S)-1-[(1S,2S)-2-(2,4-difluorophenyl)cyclopropyl]ethanamine.
| Compound Name | (1S)-1-[(1S,2S)-2-(2,4-difluorophenyl)cyclopropyl]ethanamine |
|---|---|
| PubChem CID | 29079347 |
| Molecular Formula | C11H13F2N |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | (1S)-1-[(1S,2S)-2-(2,4-difluorophenyl)cyclopropyl]ethanamine |
| SMILES | C[C@H](N)[C@H]1C[C@@H]1c1ccc(F)cc1F |
| InChI | InChI=1S/C11H13F2N/c1-6(14)9-5-10(9)8-3-2-7(12)4-11(8)13/h2-4,6,9-10H,5,14H2,1H3/t6-,9+,10+/m0/s1 |
| InChIKey | PYWFRYSSAZWFMH-WQGWLQIFSA-N |
| XLogP | 2.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |