C26H22N2O7S — CID 16734024
2-[5-(4-methoxyphenyl)-2-methyl-4-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]methoxy]phenoxy]acetic acid (PubChem CID 16734024) has the molecular formula C26H22N2O7S and a molecular weight of 506.54 g/mol. Its IUPAC name is 2-[5-(4-methoxyphenyl)-2-methyl-4-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]methoxy]phenoxy]acetic acid.
| Compound Name | 2-[5-(4-methoxyphenyl)-2-methyl-4-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]methoxy]phenoxy]acetic acid |
|---|---|
| PubChem CID | 16734024 |
| Molecular Formula | C26H22N2O7S |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | 2-[5-(4-methoxyphenyl)-2-methyl-4-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]methoxy]phenoxy]acetic acid |
| SMILES | COc1ccc(-c2cc(OCC(=O)O)c(C)cc2OCc2nc(-c3ccc([N+](=O)[O-])cc3)cs2)cc1 |
| InChI | InChI=1S/C26H22N2O7S/c1-16-11-24(21(12-23(16)35-14-26(29)30)17-5-9-20(33-2)10-6-17)34-13-25-27-22(15-36-25)18-3-7-19(8-4-18)28(31)32/h3-12,15H,13-14H2,1-2H3,(H,29,30) |
| InChIKey | HMVVNTDJNRSPII-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|